CymitQuimica logo

CAS 1946010-85-0

:

tert-butyl (2S,5S)-5-hydroxy-2-methylpiperidine-1-carboxylate

Description:
Tert-butyl (2S,5S)-5-hydroxy-2-methylpiperidine-1-carboxylate is a chemical compound characterized by its piperidine structure, which includes a hydroxyl group and a tert-butyl ester functional group. This compound features a chiral center, indicated by the (2S,5S) configuration, which contributes to its stereochemical properties and potential biological activity. The presence of the hydroxyl group suggests that it may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. The tert-butyl group enhances the lipophilicity of the molecule, potentially affecting its pharmacokinetic properties. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including esterification and chiral resolution methods. Overall, the unique combination of functional groups and stereochemistry makes this compound a subject of interest for further research and application in various chemical and pharmaceutical contexts.
Formula:C11H21NO3
InChI:InChI=1S/C11H21NO3/c1-8-5-6-9(13)7-12(8)10(14)15-11(2,3)4/h8-9,13H,5-7H2,1-4H3/t8-,9-/m0/s1
InChI key:MHIXYMAYESKVIK-IUCAKERBSA-N
SMILES:C[C@H]1CC[C@@H](CN1C(=O)OC(C)(C)C)O
Synonyms:
  • (2S,5S)-tert-Butyl 5-hydroxy-2-methylpiperidine-1-carboxylate
  • 1-Piperidinecarboxylic acid, 5-hydroxy-2-methyl-, 1,1-dimethylethyl ester, (2S,5S)-
  • tert-butyl(2S,5S)-5-hydroxy-2-methylpiperidine-1-carboxylate-H30125
  • tert-butyl (2S,5S)-5-hydroxy-2-methylpiperidine-1-carboxylate
Found 4 products.