CAS 1946010-89-4

Piperidine, 3-(methylsulfonyl)-, hydrochloride (1:1), (3S)-

Description:

Piperidine, 3-(methylsulfonyl)-, hydrochloride (1:1), (3S)- is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a methylsulfonyl group at the 3-position of the piperidine ring contributes to its unique chemical properties, including increased solubility in polar solvents and potential reactivity in various chemical reactions. As a hydrochloride salt, it is typically encountered in a crystalline form, enhancing its stability and ease of handling. This compound is of interest in medicinal chemistry due to its potential biological activities, which may include effects on neurotransmitter systems. The (3S)- designation indicates its specific stereochemistry, which can influence its pharmacological properties. Overall, this compound's characteristics make it a valuable subject for research in drug development and synthesis.

Formula: C₆H₁₃NO₂S·ClH

InChI: InChI=1S/C6H13NO2S.ClH/c1-10(8,9)6-3-2-4-7-5-6;/h6-7H,2-5H2,1H3;1H/t6-;/m0./s1

InChI key: InChIKey=MRLKRLRBGARQIK-RGMNGODLSA-N

SMILES: S(C)(=O)(=O)[C@H]1CCCNC1.Cl

Synonyms:

• Piperidine, 3-(methylsulfonyl)-, hydrochloride (1:1), (3S)-

(3S)-3-methanesulfonylpiperidine hydrochloride

CAS: 1946010-89-4

Formula: C₆H₁₄ClNO₂S

Purity: 97.0%

Color and Shape: Liquid, No data available.

Molecular weight: 199.69

Ref: 10-F519062