CAS 1946010-97-4

L-Proline, 1,5-dimethyl-, hydrochloride (1:1), (5S)-

Description:

L-Proline, 1,5-dimethyl-, hydrochloride (1:1), (5S)- is a chemical compound characterized by its structure as a derivative of proline, an amino acid. This substance features a dimethyl substitution at the 1 and 5 positions of the proline ring, which influences its steric and electronic properties. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in biochemical and pharmaceutical contexts. The (5S) designation refers to the specific stereochemistry of the molecule, indicating that it has a particular spatial arrangement that is crucial for its biological activity. Generally, compounds like this can be involved in peptide synthesis, serve as intermediates in organic synthesis, or have potential roles in medicinal chemistry due to their structural similarities to naturally occurring amino acids. As with many amino acid derivatives, it may exhibit properties such as chirality, which can affect its interaction with biological systems.

Formula: C₇H₁₃NO₂·ClH

InChI: InChI=1S/C7H13NO2.ClH/c1-5-3-4-6(7(9)10)8(5)2;/h5-6H,3-4H2,1-2H3,(H,9,10);1H/t5-,6-;/m0./s1

InChI key: InChIKey=VBPPYQMIKMHUJR-GEMLJDPKSA-N

SMILES: C(O)(=O)[C@H]1N(C)[C@@H](C)CC1.Cl

Synonyms:

• L-Proline, 1,5-dimethyl-, hydrochloride (1:1), (5S)-

(2S,5S)-1,5-dimethylpyrrolidine-2-carboxylic acid hydrochloride

CAS: 1946010-97-4

Formula: C₇H₁₄ClNO₂

Purity: 97.0%

Molecular weight: 179.64

Ref: 10-F519367