CAS 194602-23-8
:2-Ethoxy-5-[(4-methyl-1-piperazinyl)sulfonyl]benzoic acid
Description:
2-Ethoxy-5-[(4-methyl-1-piperazinyl)sulfonyl]benzoic acid is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety substituted with an ethoxy group and a sulfonamide functional group linked to a piperazine ring. This compound typically exhibits properties such as moderate solubility in organic solvents and potential solubility in polar solvents due to the presence of both hydrophobic and hydrophilic groups. The sulfonamide group may impart biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific receptors or pathways. The piperazine ring is known for its role in enhancing the pharmacological properties of compounds, often contributing to improved binding affinity and selectivity. Additionally, the presence of the ethoxy group can influence the compound's lipophilicity and overall stability. As with many organic compounds, the specific reactivity and interactions of 2-Ethoxy-5-[(4-methyl-1-piperazinyl)sulfonyl]benzoic acid would depend on its environment and the presence of other chemical species.
Formula:C14H20N2O5S
InChI:InChI=1S/C14H20N2O5S/c1-3-21-13-5-4-11(10-12(13)14(17)18)22(19,20)16-8-6-15(2)7-9-16/h4-5,10H,3,6-9H2,1-2H3,(H,17,18)
InChI key:InChIKey=TXKSEEXWAGLOIY-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=CC(C(O)=O)=C(OCC)C=C1)N2CCN(C)CC2
Synonyms:- 2-Ethoxy-5-(4-methyl-1-piperazinylsulfonyl)benzoic acid
- 2-Ethoxy-5-[(4-methyl-1-piperazinyl)sulfonyl]benzoic acid
- 2-Ethoxy-5-[(4-methylpiperazin-1-yl)sulfoyl]benzoic acid
- Benzoic acid, 2-ethoxy-5-[(4-methyl-1-piperazinyl)sulfonyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Ethoxy-5-(4-methyl-1-piperazinylsulfonyl)benzoic Acid
CAS:Controlled ProductFormula:C14H20N2O5SColor and Shape:NeatMolecular weight:328.382-Ethoxy-5-[(4-methylpiperazin-1-yl)sulfonyl]benzoic acid
CAS:2-Ethoxy-5-[(4-methylpiperazin-1-yl)sulfonyl]benzoic acid (EMSB) is a nitrogen and sulfonamide compound that belongs to the class of piperazine derivatives. It binds to the 50S ribosomal subunit in bacteria, preventing mRNA translation and inhibiting bacterial growth. EMSB has been shown to inhibit the growth of Mycobacterium tuberculosis and Staphylococcus aureus. EMSB also inhibits aminoacyl-tRNA binding and protein synthesis in bacteria. This drug has been shown to be active against methicillin resistant Staphylococcus aureus (MRSA) isolates in laboratory tests.Formula:C14H20N2O5SPurity:Min. 95%Molecular weight:328.39 g/mol2-Ethoxy-5-(4-methyl-1-piperazinylsulfonyl)benzoic Acid
CAS:Formula:C14H20N2O5SMolecular weight:328.38



