
CAS 19462-98-7
:5,6-Dichlorobenzimidazole-2-thiol
Description:
5,6-Dichlorobenzimidazole-2-thiol is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. The presence of two chlorine atoms at the 5 and 6 positions of the benzene ring contributes to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The thiol (-SH) group at the 2 position enhances its nucleophilicity, making it useful in biochemical applications, such as enzyme inhibition or as a reducing agent. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its properties can be influenced by the presence of the chlorine substituents, which can affect its electronic characteristics and interactions with other molecules. Safety data indicates that it should be handled with care due to potential toxicity and environmental impact. Overall, 5,6-Dichlorobenzimidazole-2-thiol is a versatile compound with significant relevance in chemical research and industrial applications.
Formula:C7H4Cl2N2S
InChI:InChI=1/C7H4Cl2N2S/c8-3-1-5-6(2-4(3)9)11-7(12)10-5/h1-2H,(H2,10,11,12)
SMILES:c1c(c(cc2c1nc([nH]2)S)Cl)Cl
Synonyms:- 5,6-Dichloro-1H-benzo[d]imidazole-2-thiol
- 5,6-dichloro-1,3-dihydro-2H-benzimidazole-2-thione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5,6-Dichloro-2-mercaptobenzimidazole, 98%
CAS:It is employed in the synthesis of 2?,3?-dideoxy and 2?,3?-unsaturated ribofuranonucleosides as potential antiviral agents. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand.Formula:C7H4Cl2N2SPurity:98%Color and Shape:Pale yellow to pale brown, Crystals or powder or crystalline powderMolecular weight:219.085,6-Dichloro-1H-benzo[d]imidazole-2-thiol
CAS:Formula:C7H4Cl2N2SPurity:97%Color and Shape:SolidMolecular weight:219.09115,6-Dichloro-1H-benzimidazole-2-thiol
CAS:5,6-Dichloro-1H-benzimidazole-2-thiolPurity:98%Molecular weight:219.09g/mol



