CAS 194660-14-5
:cyclo(L-alloisoleucyl-L-asparaginylglycyl-L-tryptophyl-L-leucyl-D-leucyl)
Description:
Cyclo(L-alloisoleucyl-L-asparaginylglycyl-L-tryptophyl-L-leucyl-D-leucyl) is a cyclic peptide composed of a specific sequence of amino acids, which contributes to its unique properties and potential biological activities. As a cyclic structure, it exhibits increased stability compared to its linear counterparts, often resulting in enhanced resistance to enzymatic degradation. The presence of both L- and D-amino acids in its sequence can influence its conformational flexibility and interactions with biological targets, potentially affecting its pharmacological profile. This compound may exhibit various characteristics such as solubility in polar solvents, depending on the side chains of the amino acids involved. Additionally, its cyclic nature may facilitate specific receptor binding or biological activity, making it of interest in medicinal chemistry and drug design. The CAS number 194660-14-5 allows for precise identification and retrieval of information regarding this substance in chemical databases. Overall, the unique arrangement of amino acids in this cyclic peptide suggests potential applications in therapeutic contexts, although further research would be necessary to elucidate its specific functions and efficacy.
Formula:C35H52N8O7
InChI:InChI=1/C35H52N8O7/c1-7-20(6)30-35(50)42-27(15-28(36)44)31(46)38-17-29(45)39-26(14-21-16-37-23-11-9-8-10-22(21)23)33(48)40-24(12-18(2)3)32(47)41-25(13-19(4)5)34(49)43-30/h8-11,16,18-20,24-27,30,37H,7,12-15,17H2,1-6H3,(H2,36,44)(H,38,46)(H,39,45)(H,40,48)(H,41,47)(H,42,50)(H,43,49)/t20-,24+,25-,26+,27+,30+/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Desotamide
CAS:Desotamide: an antibiotic cyclic hexapeptide targeting S. aureus, S. pneumoniae, and MRSE with MICs 16, 12.5, 32 μg/ml.Formula:C35H52N8O7Color and Shape:SolidMolecular weight:696.84
