CAS 19467-38-0
:1-Propanaminium, 2-hydroxy-N,N,N-trimethyl-3-[[(9Z)-1-oxo-9-octadecen-1-yl]oxy]-, chloride (1:1)
Description:
1-Propanaminium, 2-hydroxy-N,N,N-trimethyl-3-[[(9Z)-1-oxo-9-octadecen-1-yl]oxy]-, chloride (1:1), commonly referred to as a quaternary ammonium compound, exhibits surfactant properties due to its amphiphilic nature, which allows it to interact with both hydrophilic and hydrophobic substances. This compound features a long hydrophobic hydrocarbon chain derived from oleic acid, contributing to its ability to reduce surface tension and enhance solubility in various formulations. The presence of the trimethylammonium group imparts cationic characteristics, making it effective in applications such as emulsifiers, conditioners, and antimicrobial agents. Its chloride salt form indicates it is soluble in water, which is beneficial for various industrial and cosmetic applications. Additionally, the hydroxyl group enhances its reactivity and potential for forming hydrogen bonds, further influencing its behavior in different environments. Overall, this compound is valuable in formulations requiring stability, compatibility, and effective interaction with biological systems or surfaces.
Formula:C24H48NO3·Cl
InChI:InChI=1/C24H48NO3.ClH/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24(27)28-22-23(26)21-25(2,3)4;/h12-13,23,26H,5-11,14-22H2,1-4H3;1H/q+1;/p-1/b13-12-;
InChI key:InChIKey=OYUNFRDRYWKVEV-USGGBSEENA-M
SMILES:O(C(CCCCCCC/C=C\CCCCCCCC)=O)CC(C[N+](C)(C)C)O.[Cl-]
Synonyms:- 1-Propanaminium, 2-hydroxy-N,N,N-trimethyl-3-[(1-oxo-9-octadecenyl)oxy]-, chloride, (Z)-
- 1-Propanaminium, 2-hydroxy-N,N,N-trimethyl-3-[[(9Z)-1-oxo-9-octadecen-1-yl]oxy]-, chloride (1:1)
- 2-Hydroxy-3-oleoyloxypropyltrimethylammonium chloride
- Ammonium, (2,3-dihydroxypropyl)trimethyl-, chloride, 3-oleate
- [2-hydroxy-3-[(Z)-octadec-9-enoyl]oxy-propyl]-trimethyl-ammonium chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

