CAS 1946820-91-2
:L-erythro-Pentonic acid, 2-deoxy-2-fluoro-2-methyl-, γ-lactone, 3,5-dibenzoate, (2S)-
Description:
L-erythro-Pentonic acid, 2-deoxy-2-fluoro-2-methyl-, γ-lactone, 3,5-dibenzoate, (2S)- is a complex organic compound characterized by its specific stereochemistry and functional groups. This substance features a pentonic acid backbone, which is a five-carbon sugar acid, modified by the presence of a deoxy group (indicating the absence of an oxygen atom), a fluoro group (introducing a fluorine atom), and a methyl group. The γ-lactone structure indicates that it forms a cyclic ester, which is derived from the condensation of the carboxylic acid and alcohol functional groups. The presence of the 3,5-dibenzoate moiety suggests that the compound has two benzoate groups attached, which can influence its solubility, stability, and biological activity. The (2S) designation indicates the specific stereochemistry at the second carbon, which is crucial for the compound's interaction with biological systems. Overall, this compound may exhibit unique properties and potential applications in pharmaceuticals or biochemistry due to its structural features.
Formula:C20H17FO6
InChI:InChI=1S/C20H17FO6/c1-20(21)16(27-18(23)14-10-6-3-7-11-14)15(26-19(20)24)12-25-17(22)13-8-4-2-5-9-13/h2-11,15-16H,12H2,1H3/t15-,16-,20-/m0/s1
InChI key:InChIKey=OUKYMZJNLWKCSO-FTRWYGJKSA-N
SMILES:C(OC(=O)C1=CC=CC=C1)[C@H]2[C@H](OC(=O)C3=CC=CC=C3)[C@](C)(F)C(=O)O2
Synonyms:- L-erythro-Pentonic acid, 2-deoxy-2-fluoro-2-methyl-, γ-lactone, 3,5-dibenzoate, (2S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
