CAS 1947-00-8: N-(Benzyloxycarbonyl)-6-aminohexanoic acid
Description:N-(Benzyloxycarbonyl)-6-aminohexanoic acid, also known as Z-6-aminohexanoic acid, is an amino acid derivative characterized by the presence of a benzyloxycarbonyl (Z) protecting group on the amino group of 6-aminohexanoic acid. This compound features a hexanoic acid backbone with an amino group at the sixth carbon, which contributes to its properties as a building block in peptide synthesis. The benzyloxycarbonyl group enhances the stability of the amino group during chemical reactions, making it useful in various synthetic applications, particularly in the field of organic chemistry and peptide synthesis. The compound is typically a white to off-white solid and is soluble in organic solvents, with limited solubility in water. Its structure allows for the introduction of further functional groups, making it versatile for modifications. As with many amino acid derivatives, it may exhibit biological activity, and its derivatives can be explored for pharmaceutical applications. Proper handling and storage are essential due to its chemical properties and potential reactivity.
Formula:C14H19NO4
InChI:InChI=1S/C14H19NO4/c16-13(17)9-5-2-6-10-15-14(18)19-11-12-7-3-1-4-8-12/h1,3-4,7-8H,2,5-6,9-11H2,(H,15,18)(H,16,17)
InChI key:InChIKey=RXQDBVWDABAAHL-UHFFFAOYSA-N
SMILES:O=C(O)CCCCCNC(=O)OCC=1C=CC=CC1
- Synonyms:
- 6-(Benzyloxycarbonylamino)caproic acid
- 6-(N-Benzyloxycarbonylamino)hexanoic acid
- 6-(N-Carbobenzyloxyamino)hexanoic acid
- 6-[(Benzyloxycarbonyl)amino]hexanoic acid
- 6-[(Carbobenzyloxy)amino]caproic acid
- 6-[[(Phenylmethoxy)carbonyl]amino]hexanoic acid
- 6-{[(Benzyloxy)Carbonyl]Amino}Hexanoate
- 6-{[(Benzyloxy)Carbonyl]Amino}Hexanoic Acid
- Carbobenzoxy-ε-aminocaproic acid
- Hexanoic acid, 6-(carboxyamino)-, N-benzyl ester
- See more synonyms
- Hexanoic acid, 6-[[(phenylmethoxy)carbonyl]amino]-
- N-(Benzyloxycarbonyl)-ε-aminocaproic acid
- N-(Carbobenzoxy)-6-aminocaproic acid
- N-Benzyloxycarbonyl-6-Aminocaproic Acid
- N-Benzyloxycarbonyl-6-Aminohexanoic Acid
- N-Carbobenzoxy-ε-aminohexanoic acid
- N-Cbz-6-Aminocaproic Acid
- N-Cbz-6-Aminohexanoic Acid
- N-Epsilon-Carbobenzoxy-6-Aminocaproic Acid
- N-Epsilon-Cbz-Epsilon-Aminocaproic Acid
- N-Gamma-Carbobenzoxy-6-Aminohexanoic Acid
- NSC 92812
- Vib 197
