CAS 1947-47-3
:3-Amino-2-phenyl-1H-inden-1-one
Description:
3-Amino-2-phenyl-1H-inden-1-one is an organic compound characterized by its unique bicyclic structure, which consists of an indene core with an amino group and a phenyl substituent. This compound typically exhibits a solid state at room temperature and is known for its potential applications in pharmaceuticals and organic synthesis due to the presence of both the amino and carbonyl functional groups. The amino group can participate in various chemical reactions, making it a versatile intermediate in organic chemistry. Additionally, the phenyl group contributes to the compound's aromatic properties, which can influence its reactivity and interactions with other molecules. The compound's molecular structure allows for potential hydrogen bonding and dipole interactions, which can affect its solubility and stability in different solvents. Overall, 3-Amino-2-phenyl-1H-inden-1-one is of interest for its chemical properties and potential applications in medicinal chemistry and materials science.
Formula:C15H11NO
InChI:InChI=1S/C15H11NO/c16-14-11-8-4-5-9-12(11)15(17)13(14)10-6-2-1-3-7-10/h1-9H,16H2
InChI key:InChIKey=HLEKBTIHDXNOQP-UHFFFAOYSA-N
SMILES:NC1=C(C(=O)C=2C1=CC=CC2)C3=CC=CC=C3
Synonyms:- (2R,3Z)-3-imino-2-phenyl-2,3-dihydro-1H-inden-1-one
- 1H-Inden-1-one, 3-amino-2-phenyl-
- 3-Amino-2-phenyl-1H-inden-1-one
- 3-Amino-2-phenylinden-1-one
- 3-Amino-2-phenylindene-1-one
- Indone, 3-amino-2-phenyl-
- NSC 156175
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-amino-2-phenyl-1H-inden-1-one
CAS:3-amino-2-phenyl-1H-inden-1-onePurity:95%Molecular weight:221.25g/mol3-Amino-2-phenylindenone
CAS:3-Amino-2-phenylindenone is a lactam molecule with a five-membered ring and a carbonyl group. The compound's acetylation, protonation, and skeleton are important to its structure. 3-Amino-2-phenylindenone is an aromatic compound that has two deuterium atoms. It has the chemical formula C9H6N2O2, which consists of one chloride atom and two nitro groups. 3-Amino-2-phenylindenone has three deuterium atoms that can be seen in its proton resonances at 1.5 ppm on the IR spectrum. The compound's proton resonances are at 2.8 ppm on the IR spectrum. The compound's chloroformate can be seen in its IR spectrum at 1780 cm^(-1). This molecule has no nonequivalence in its bonds because it does not have any double or
Formula:C15H11NOPurity:Min. 95%Color and Shape:PowderMolecular weight:221.25 g/molRef: 3D-FA168839
Discontinued product



