CAS 19477-73-7

6-BROMO-3 H-ISOBENZOFURAN-1-ONE

Description:

6-Bromo-3H-isobenzofuran-1-one is an organic compound characterized by its unique bicyclic structure, which consists of a fused isobenzofuran and a carbonyl group. The presence of the bromine atom at the 6-position contributes to its reactivity and potential applications in organic synthesis. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as dichloromethane and ethanol, but may have limited solubility in water. Its molecular structure allows for various chemical transformations, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. The compound's reactivity can be attributed to the electrophilic nature of the carbonyl group, which can participate in nucleophilic addition reactions. Additionally, the bromine substituent can serve as a site for further functionalization, enhancing its utility in synthetic chemistry. Safety data indicates that, like many brominated compounds, it should be handled with care due to potential toxicity and environmental concerns.

Formula: C₈H₅BrO₂

InChI: InChI=1/C8H5BrO2/c9-6-2-1-5-4-11-8(10)7(5)3-6/h1-3H,4H2

SMILES: c1cc(cc2c1COC2=O)Br

Synonyms:

• 1(3H)-Isobenzofuranone, 6-bromo-
• 6-Bromo-2-benzofuran-1(3H)-one
• 6-Bromo-3H-isobenzofuran-1-one
• 6-Bromophthalide

6-BROMO-3 H-ISOBENZOFURAN-1-ONE

CAS: 19477-73-7

Formula: C₈H₅BrO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 213.0281

Ref: IN-DA007RH1

6-Bromophthalide

CAS: 19477-73-7

6-Bromophthalide

Purity: 98%

Molecular weight: 213.03g/mol

Ref: 54-OR400356

6-Bromo-3H-isobenzofuran-1-one

Controlled Product

CAS: 19477-73-7

Applications 6-Bromo-3H-isobenzofuran-1-one

Formula: C₈H₅BrO₂

Color and Shape: Neat

Molecular weight: 213.03

Ref: TR-B688668

6-Bromo-3H-isobenzofuran-1-one

CAS: 19477-73-7

Formula: C₈H₅BrO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 213.03

Ref: 10-F026924