CymitQuimica logo

CAS 194783-82-9

:

N-(3-Acetylphenyl)-4-fluorobenzamide

Description:
N-(3-Acetylphenyl)-4-fluorobenzamide, with the CAS number 194783-82-9, is an organic compound characterized by its amide functional group, which is formed from the reaction of an amine and a carboxylic acid. This compound features a fluorine atom substituted on a benzene ring, which can influence its chemical reactivity and biological activity. The presence of the acetyl group on the phenyl ring contributes to its overall polarity and can affect its solubility in various solvents. Typically, compounds like this may exhibit properties such as moderate to high melting points and may be soluble in organic solvents. The fluorine substitution can enhance the compound's lipophilicity, potentially impacting its pharmacokinetic properties if considered for medicinal applications. Additionally, the structural arrangement suggests potential interactions with biological targets, making it of interest in pharmaceutical research. Overall, N-(3-Acetylphenyl)-4-fluorobenzamide is a compound of interest in both synthetic organic chemistry and medicinal chemistry due to its unique structural features.
Formula:C15H12FNO2
InChI:InChI=1S/C15H12FNO2/c1-10(18)12-3-2-4-14(9-12)17-15(19)11-5-7-13(16)8-6-11/h2-9H,1H3,(H,17,19)
InChI key:InChIKey=LXJNMMGOVWWKIJ-UHFFFAOYSA-N
SMILES:C(NC1=CC(C(C)=O)=CC=C1)(=O)C2=CC=C(F)C=C2
Synonyms:
  • N-(3-Acetylphenyl)-4-fluorobenzamide
  • NSC 214044
  • Benzamide, N-(3-acetylphenyl)-4-fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.