CAS 194788-10-8

3-Hydroxycyclobutanecarboxylic acid

Description:

3-Hydroxycyclobutanecarboxylic acid is a cyclic organic compound characterized by the presence of a cyclobutane ring, a carboxylic acid functional group, and a hydroxyl group. Its molecular structure features a four-membered carbon ring with a hydroxyl (-OH) group attached to the third carbon and a carboxylic acid (-COOH) group attached to the first carbon. This compound is notable for its potential applications in organic synthesis and as a building block in the development of pharmaceuticals and agrochemicals. The presence of both hydroxyl and carboxylic acid groups contributes to its acidity and reactivity, making it a versatile intermediate in various chemical reactions. Additionally, the unique ring structure may impart specific steric and electronic properties that can influence its behavior in chemical processes. As with many organic acids, it is expected to exhibit solubility in polar solvents and may participate in hydrogen bonding due to the hydroxyl group. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards.

Formula: C₅H₈O₃

InChI: InChI=1/C5H8O3/c6-4-1-3(2-4)5(7)8/h3-4,6H,1-2H2,(H,7,8)

SMILES: C1C(CC1O)C(=O)O

Synonyms:

• Cyclobutanecarboxylic Acid, 3-Hydroxy-
• 3-Hydroxy-cyclobutanecarboxylic acid

3-Hydroxycyclobutanecarboxylic acid

CAS: 194788-10-8

Formula: C₅H₈O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 116.1152

Ref: IN-DA0074I5

3-Hydroxycyclobutanecarboxylic acid

CAS: 194788-10-8

3-Hydroxycyclobutanecarboxylic acid

Formula: C₅H₈O₃

Purity: 97%

Color and Shape: white solid

Molecular weight: 116.12g/mol

Ref: 54-OR308101

3-Hydroxycyclobutanecarboxylic acid

CAS: 194788-10-8

Formula: C₅H₈O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 116.116

Ref: 10-F092072