CAS 1948-52-3
:Propyl propanethiosulfinate
Description:
Propyl propanethiosulfinate, with the CAS number 1948-52-3, is an organosulfur compound characterized by its distinctive thiosulfinate functional group. This compound typically appears as a colorless to pale yellow liquid and is known for its strong, pungent odor, reminiscent of garlic, which is common among sulfur-containing compounds. It is soluble in organic solvents but has limited solubility in water. Propyl propanethiosulfinate is primarily recognized for its use in flavoring and fragrance applications, particularly in the food industry, where it contributes to the characteristic taste and aroma of certain foods. Additionally, it exhibits antimicrobial properties, making it of interest in food preservation and safety. The compound is relatively stable under normal conditions but may decompose upon exposure to heat or light, leading to the release of sulfur dioxide and other byproducts. As with many organosulfur compounds, handling should be done with care due to potential irritant effects on the skin and respiratory system.
Formula:C6H14OS2
InChI:InChI=1S/C6H14OS2/c1-3-5-8-9(7)6-4-2/h3-6H2,1-2H3
InChI key:InChIKey=XPRZAEWSYWTDSQ-UHFFFAOYSA-N
SMILES:S(SCCC)(CCC)=O
Synonyms:- Propyl propanethiosulfinate
- 1-Propanesulfinothioic acid, S-propyl ester
- 1-Propyl propanethiosulfinate
- NSC 23131
- 1-Propanesulfinic acid, thio-, S-propyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
