CAS 194804-80-3
:Methyl 2,4-difluoro-3-hydroxybenzoate
Description:
Methyl 2,4-difluoro-3-hydroxybenzoate, with the CAS number 194804-80-3, is an organic compound that belongs to the class of benzoates. It features a benzoic acid derivative structure, where a methyl ester group is attached to the carboxylic acid moiety. The presence of two fluorine atoms at the 2 and 4 positions on the aromatic ring, along with a hydroxyl group at the 3 position, contributes to its unique chemical properties. This compound is characterized by its moderate polarity due to the hydroxyl group, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. The fluorine substituents can influence the compound's reactivity and stability, often making it more resistant to degradation. Methyl 2,4-difluoro-3-hydroxybenzoate may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, owing to its functional groups that can undergo further chemical transformations. Safety and handling precautions should be observed, as with any chemical substance, to mitigate potential hazards.
Formula:C8H6F2O3
InChI:InChI=1S/C8H6F2O3/c1-13-8(12)4-2-3-5(9)7(11)6(4)10/h2-3,11H,1H3
InChI key:InChIKey=IASILBBAKSGQJC-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(F)C(O)=C(F)C=C1
Synonyms:- Methyl 2,4-difluoro-3-hydroxybenzoate
- 2,4-Difluoro-3-hydroxybenzoic acid methyl ester
- Benzoic acid, 2,4-difluoro-3-hydroxy-, methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 2,4-difluoro-3-hydroxybenzoate
CAS:<p>Methyl 2,4-difluoro-3-hydroxybenzoate</p>Molecular weight:188.12825g/mol2,4-difluoro-3-hydroxybenzoic acid methyl ester, 95%
CAS:Formula:C8H6F2O3Purity:95.0%Color and Shape:SolidMolecular weight:188.132,4-Difluoro-3-hydroxybenzoic acid methyl ester
CAS:<p>2,4-Difluoro-3-hydroxybenzoic acid methyl ester is a fine chemical that is used as a versatile building block for research chemicals and other complex compounds. It can be used as a reaction component in the synthesis of new chemical entities or as a reagent for organic chemistry reactions. 2,4-Difluoro-3-hydroxybenzoic acid methyl ester has CAS No. 194804-80-3 and is available in high quality.</p>Formula:C8H6F2O3Purity:Min. 95%Color and Shape:PowderMolecular weight:188.13 g/mol




