CAS 194804-91-6

4-Bromo-2,3-Difluorobenzoic Acid

Description:

4-Bromo-2,3-Difluorobenzoic acid is an aromatic carboxylic acid characterized by the presence of a bromine atom and two fluorine atoms on a benzene ring, specifically at the 4, 2, and 3 positions, respectively. This compound features a carboxylic acid functional group (-COOH), which contributes to its acidic properties. The presence of halogen substituents, such as bromine and fluorine, can significantly influence the compound's reactivity, polarity, and solubility in various solvents. Typically, halogenated benzoic acids exhibit enhanced lipophilicity due to the electronegative nature of the halogens, which can affect their interactions in biological systems and their utility in organic synthesis. The compound may also exhibit interesting thermal and spectral properties, making it useful in various applications, including pharmaceuticals and agrochemicals. Its molecular structure allows for potential hydrogen bonding, which can influence its physical properties, such as melting and boiling points. Overall, 4-Bromo-2,3-Difluorobenzoic acid is a valuable compound in the field of organic chemistry.

Formula: C₇H₃BrF₂O₂

InChI: InChI=1/C7H3BrF2O2/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2H,(H,11,12)

SMILES: c1cc(c(c(c1C(=O)O)F)F)Br

Synonyms:

• 4-Bromo-2,3-Difluoro Benzenecarboxylic Acid
• 2,3-Difluoro-4-bromobenzoic acid

4-Bromo-2,3-difluorobenzoic acid

CAS: 194804-91-6

Formula: C₇H₃BrF₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 236.9983

Ref: IN-DA007RFN

4-Bromo-2,3-difluorobenzoic acid

CAS: 194804-91-6

4-Bromo-2,3-difluorobenzoic acid

Formula: C₇H₃BrF₂O₂

Purity: 98%

Color and Shape: white to grey solid

Molecular weight: 237.00g/mol

Ref: 54-PC9173

4-Bromo-2,3-difluorobenzoic acid

CAS: 194804-91-6

Formula: C₇H₃BrF₂O₂

Purity: 97%

Color and Shape: Solid, Crystalline

Molecular weight: 237

Ref: 10-F037604