CAS 19485-35-9

4,5-Dicyano-1-methyl-1H-imidazole

Description:

4,5-Dicyano-1-methyl-1H-imidazole is a heterocyclic organic compound characterized by its imidazole ring, which is substituted at the 1-position with a methyl group and at the 4 and 5 positions with cyano groups. This compound is typically a solid at room temperature and is known for its stability and relatively low solubility in water, although it may dissolve in organic solvents. The presence of cyano groups contributes to its electron-withdrawing properties, making it a useful intermediate in organic synthesis and materials science. It exhibits notable reactivity due to the cyano groups, which can participate in various chemical reactions, including nucleophilic additions and cycloadditions. Additionally, 4,5-Dicyano-1-methyl-1H-imidazole can serve as a ligand in coordination chemistry and has potential applications in the development of electronic materials and sensors. Its unique structure and properties make it a subject of interest in both academic research and industrial applications.

Formula: C₆H₄N₄

InChI: InChI=1/C6H4N4/c1-10-4-9-5(2-7)6(10)3-8/h4H,1H3

SMILES: Cn1cnc(C#N)c1C#N

Synonyms:

• 1-Methyl-1H-imidazole-4,5-dicarbonitrile

1-methyl-1H-imidazole-4,5-dicarbonitrile

CAS: 19485-35-9

Formula: C₆H₄N₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 132.1228

Ref: IN-DA003EIL

1-Methyl-1H-imidazole-4,5-dicarbonitrile

CAS: 19485-35-9

1-Methyl-1H-imidazole-4,5-dicarbonitrile

Purity: 98%

Molecular weight: 132.12g/mol

Ref: 54-OR0370

1-Methyl-1H-imidazole-4,5-dicarbonitrile

CAS: 19485-35-9

1-Methyl-1H-imidazole-4,5-dicarbonitrile

Purity: 98%

Molecular weight: 132.12g/mol

Ref: 54-OR80313

1-Methyl-1H-imidazole-4,5-dicarbonitrile

CAS: 19485-35-9

Formula: C₆H₄N₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 132.126

Ref: 10-F237075