CAS 194862-84-5

8-oxa-2-azaspiro[4.5]decan-3-one

Description:

8-Oxa-2-azaspiro[4.5]decan-3-one is a heterocyclic organic compound characterized by its unique spirocyclic structure, which includes both nitrogen and oxygen atoms in its ring system. The compound features a spiro arrangement, where two rings share a single atom, contributing to its distinctive three-dimensional geometry. The presence of the nitrogen atom in the azaspiro structure imparts basicity and potential reactivity, while the carbonyl group (ketone) at the 3-position enhances its electrophilic character, making it a candidate for various chemical reactions, including nucleophilic attacks. This compound may exhibit interesting biological activities due to its structural features, which can influence its interaction with biological targets. Additionally, its solubility and stability can vary depending on the solvent and environmental conditions, making it relevant for applications in medicinal chemistry and material science. Overall, 8-oxa-2-azaspiro[4.5]decan-3-one represents a versatile scaffold for further chemical exploration and potential therapeutic development.

Formula: C₈H₁₃NO₂

InChI: InChI=1/C8H13NO2/c10-7-5-8(6-9-7)1-3-11-4-2-8/h1-6H2,(H,9,10)

SMILES: C1COCCC21CC(=NC2)O

Synonyms:

• 8-Oxa-2-azaspiro[4.5]decan-3-on

8-Oxa-2-aza-spiro[4.5]decan-3-one

CAS: 194862-84-5

Formula: C₈H₁₃NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 155.1943

Ref: IN-DA00ABI8

8-Oxa-2-azaspiro[4.5]decan-3-one

CAS: 194862-84-5

8-Oxa-2-azaspiro[4.5]decan-3-one

Purity: 98%

Molecular weight: 155.19g/mol

Ref: 54-OR923853

8-Oxa-2-azaspiro[4.5]decan-3-one

CAS: 194862-84-5

Formula: C₈H₁₃NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 155.197

Ref: 10-F234674

8-Oxa-2-azaspiro[4.5]decan-3-one

CAS: 194862-84-5

Versatile small molecule scaffold

Formula: C₈H₁₃NO₂

Purity: Min. 95%

Molecular weight: 155.19 g/mol

Ref: 3D-UHA86284