CAS 1949-88-8
:L-Altrose
Description:
L-Altrose is a monosaccharide, specifically an aldohexose, characterized by its six-carbon structure and the presence of an aldehyde functional group. It is an isomer of glucose and galactose, differing in the configuration of its hydroxyl groups. L-Altrose is typically found in a pyranose form, which is a six-membered ring structure, although it can also exist in a linear form. This sugar is known for its sweet taste and is soluble in water, making it relevant in various biochemical applications. L-Altrose participates in several metabolic pathways and can be utilized by certain microorganisms. Its CAS number, 1949-88-8, is a unique identifier that helps in the classification and study of this compound in scientific literature. Additionally, L-Altrose can be involved in glycosylation reactions, contributing to the formation of glycoproteins and glycolipids, which are essential for cellular functions. Overall, L-Altrose plays a significant role in carbohydrate chemistry and biochemistry.
Formula:C6H12O6
InChI:InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4-,5+,6-/m0/s1
InChI key:InChIKey=GZCGUPFRVQAUEE-AZGQCCRYSA-N
SMILES:[C@@H]([C@@H]([C@H](C=O)O)O)([C@H](CO)O)O
Synonyms:- <span class="text-smallcaps">L</span>-Altrose
- Altrose, <span class="text-smallcaps">L</span>-
- L-Altropyranose
- alpha-L-altropyranose
- beta-L-altropyranose
- L-Altrose
- Altrose, L-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(2R,3S,4S,5S)-2,3,4,5,6-Pentahydroxyhexanal
CAS:Formula:C6H12O6Purity:99%Color and Shape:SolidMolecular weight:180.1559L-Altrose
CAS:L-Altrose is a carbohydrate that is used as a nutrient and sweetener. It is a dextrose monomer with an L-arabinose side chain. L-Altrose has been shown to be a stereoselective carbon source that can be used in the synthesis of various biologically active compounds, such as antibiotics. L-Altrose has also been shown to stimulate growth of yeast cells in the absence of oxygen by providing an extracellular carbon source. This compound can be hydrolyzed by ring-opening or benzoylation reactions to yield dextrose.
Formula:C6H12O6Purity:Min. 99 Area-%Color and Shape:White PowderMolecular weight:180.16 g/mol


