CAS 19490-60-9
:Propiophenone, 2-amino-3,4-dihydroxy-, ()- (8CI)
Description:
Propiophenone, 2-amino-3,4-dihydroxy-, also known by its CAS number 19490-60-9, is an organic compound characterized by its structural features, which include an amino group and two hydroxyl groups attached to a propiophenone backbone. This compound typically appears as a solid and is soluble in polar solvents due to the presence of hydroxyl groups, which can engage in hydrogen bonding. The amino group contributes to its basicity and potential reactivity in various chemical reactions, including nucleophilic substitutions and coupling reactions. The dihydroxy substitution pattern suggests that it may exhibit antioxidant properties, making it of interest in biochemical applications. Additionally, the stereochemistry indicated by the designation "()" suggests that it exists as a racemic mixture, containing both enantiomers. Propiophenone derivatives are often studied for their potential pharmacological activities, including analgesic and anti-inflammatory effects. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C9H11NO3
InChI:InChI=1/C9H11NO3/c1-5(10)9(13)6-2-3-7(11)8(12)4-6/h2-5,11-12H,10H2,1H3
SMILES:CC(C(=O)c1ccc(c(c1)O)O)N
Synonyms:- 2-Amino-1-(3,4-Dihydroxyphenyl)Propan-1-One
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Amino-3',4'-dihydroxypropiophenone
CAS:Controlled Product<p>Stability Hygroscopic<br>Applications 2-Amino-3',4'-dihydroxypropiophenone (cas# 19490-60-9) is a compound useful in organic synthesis.<br></p>Formula:C9H11NO3Color and Shape:NeatMolecular weight:181.19
