CAS 19492-02-5: 6-CHLORO-7-HYDROXY-4-METHYL-2H-CHROMEN-2-ONE

Description:6-Chloro-7-hydroxy-4-methyl-2H-chromen-2-one, also known as a flavonoid compound, is characterized by its chromenone structure, which features a benzopyran ring system. This compound typically exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties, making it of interest in pharmacological research. The presence of the chlorine atom at the 6-position and the hydroxyl group at the 7-position contributes to its reactivity and solubility in various solvents. The methyl group at the 4-position can influence its lipophilicity and biological interactions. As a flavonoid derivative, it may also participate in various biochemical pathways, interacting with enzymes and receptors. Its molecular structure allows for potential applications in medicinal chemistry, particularly in the development of therapeutic agents. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its practical applications.

Formula:C₁₀H₇ClO₃

InChI:InChI=1/C10H7ClO3/c1-5-2-10(13)14-9-4-8(12)7(11)3-6(5)9/h2-4,12H,1H3

Synonyms:
Timtec-Bb Sbb003445
6-Chloro-7-Hydroxy-4-Methylcoumarin

Found 5 products.

Product data	Purity	Price range	Estimated delivery
6-Chloro-7-hydroxy-4-methylcoumarin REF: 3B-C3319CAS: 19492-02-5	>98.0%(GC)	111.00 €~350.00 €	Mon 07 Apr 25
2H-1-Benzopyran-2-one,6-chloro-7-hydroxy-4-methyl- REF: IN-DA0074H9CAS: 19492-02-5	98%	61.00 €~530.00 €	Mon 14 Apr 25
6-chloro-7-hydroxy-4-methyl-2H-chromen-2-one REF: 54-OR26936CAS: 19492-02-5	98%	47.00 €~1,906.00 €	Tue 15 Apr 25
6-chloro-7-hydroxy-4-methyl-2H-chromen-2-one REF: 10-F370455CAS: 19492-02-5	98.0%	To inquire	Thu 24 Apr 25
6-Chloro-7-hydroxy-4-methylcoumarin REF: 3D-FC45294CAS: 19492-02-5	Min. 95%	- - -	Discontinued product