CAS 19492-87-6

Benzo[b]thiophene, 5-bromo-, 1,1-dioxide

Description:

Benzo[b]thiophene, 5-bromo-, 1,1-dioxide, with the CAS number 19492-87-6, is a heterocyclic organic compound characterized by its fused ring structure that includes a thiophene ring and a benzene ring. The presence of a bromine atom at the 5-position of the benzo[b]thiophene structure contributes to its reactivity and potential applications in various chemical reactions. The 1,1-dioxide functional group indicates the presence of two oxygen atoms bonded to the sulfur atom in the thiophene ring, which enhances the compound's stability and solubility in polar solvents. This compound is of interest in organic synthesis and materials science due to its unique electronic properties and potential use in the development of organic semiconductors and dyes. Additionally, its brominated form may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry. Overall, benzo[b]thiophene, 5-bromo-, 1,1-dioxide is a versatile compound with significant implications in both industrial and research applications.

Formula: C₈H₅BrO₂S

InChI: InChI=1S/C8H5BrO2S/c9-7-1-2-8-6(5-7)3-4-12(8,10)11/h1-5H

InChI key: InChIKey=SHMDLUBMDUJLOG-UHFFFAOYSA-N

SMILES: O=S1(=O)C=2C(C=C1)=CC(Br)=CC2

Synonyms:

• Benzo[b]thiophene, 5-bromo-, 1,1-dioxide
• 5-Bromo-1-benzothiophene 1,1-dioxide

5-​Bromo-​benzo[b]​thiophene 1,​1-​dioxide

CAS: 19492-87-6

Versatile small molecule scaffold

Formula: C₈H₅BrO₂S

Purity: Min. 95%

Molecular weight: 245.09 g/mol

Ref: 3D-UAA49287