CAS 19494-89-4

2-[(5-Hydroxy-2-pyridinyl)methylene]hydrazinecarbothioamide

Description:

2-[(5-Hydroxy-2-pyridinyl)methylene]hydrazinecarbothioamide, with the CAS number 19494-89-4, is a chemical compound characterized by its unique structural features, including a hydrazinecarbothioamide moiety and a pyridine ring with a hydroxyl group. This compound typically exhibits properties associated with both hydrazine derivatives and thioamide functionalities, which may contribute to its reactivity and potential biological activity. The presence of the hydroxyl group on the pyridine ring can enhance hydrogen bonding capabilities, influencing solubility and interaction with biological targets. Additionally, the thioamide group may impart distinct chemical reactivity, making it a candidate for various synthetic applications or biological studies. The compound's potential applications could span medicinal chemistry, where it may serve as a lead compound for drug development, particularly in areas targeting specific enzymatic pathways or receptor interactions. Overall, 2-[(5-Hydroxy-2-pyridinyl)methylene]hydrazinecarbothioamide represents a versatile structure with implications in both research and practical applications in chemistry and pharmacology.

Formula: C₇H₈N₄OS

InChI: InChI=1S/C7H8N4OS/c8-7(13)11-10-3-5-1-2-6(12)4-9-5/h1-4,12H,(H3,8,11,13)

InChI key: InChIKey=LJHGXGDHNOZLFT-UHFFFAOYSA-N

SMILES: C(=NNC(N)=S)C1=CC=C(O)C=N1

Synonyms:

• 5-Hydroxypicolinaldehyde thiosemicarbazone
• Picolinaldehyde, 5-hydroxy-, thiosemicarbazone
• 2-[(5-Hydroxy-2-pyridinyl)methylene]hydrazinecarbothioamide
• Hydrazinecarbothioamide, 2-[(5-hydroxy-2-pyridinyl)methylene]-
• 5-Hydroxy-2-formylpyridine thiosemicarbazone

NSC107392

CAS: 19494-89-4

NSC107392 is a substrate of ABCG2.

Formula: C₇H₈N₄OS

Color and Shape: Solid

Molecular weight: 196.23

Ref: TM-T33749