CAS 1949815-78-4

2(1H)-Pyridinone, 5-[(methylamino)methyl]-, hydrobromide (1:2)

Description:

2(1H)-Pyridinone, 5-[(methylamino)methyl]-, hydrobromide (1:2) is a chemical compound characterized by its pyridinone core structure, which features a nitrogen-containing heterocyclic ring. This compound includes a methylamino group attached to a methylene bridge, enhancing its potential for biological activity. The hydrobromide salt form indicates that it is combined with hydrobromic acid, which can influence its solubility and stability in various solvents. Typically, such compounds may exhibit properties relevant to medicinal chemistry, including potential antimicrobial or pharmacological effects. The presence of the methylamino group suggests possible interactions with biological targets, making it of interest in drug development. Its molecular structure contributes to its reactivity and interaction with other chemical species. As with many pyridine derivatives, it may also participate in hydrogen bonding and exhibit basicity due to the nitrogen atom in the ring. Overall, this compound's characteristics make it a subject of interest in both synthetic and medicinal chemistry research.

Formula: C₇H₁₀N₂O·2BrH

InChI: InChI=1S/C7H10N2O.2BrH/c1-8-4-6-2-3-7(10)9-5-6;;/h2-3,5,8H,4H2,1H3,(H,9,10);2*1H

InChI key: InChIKey=YYTCSJXGUWWSSJ-UHFFFAOYSA-N

SMILES: C(NC)C=1C=CC(=O)NC1.Br

Synonyms:

• 2(1H)-Pyridinone, 5-[(methylamino)methyl]-, hydrobromide (1:2)

5-((methylamino)methyl)pyridin-2(1H)-one dihydrobromide

CAS: 1949815-78-4

Formula: C₇H₁₂Br₂N₂O

Purity: 95.0%

Molecular weight: 299.994

Ref: 10-F512192