CAS 1949816-35-6

Piperidine, 4-cyclopropylidene-, hydrochloride (1:1)

Description:

Piperidine, 4-cyclopropylidene-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a cyclopropylidene group at the 4-position of the piperidine ring introduces unique steric and electronic properties, potentially influencing its reactivity and interaction with biological systems. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, including pharmaceuticals and organic synthesis. The compound may exhibit basic properties due to the nitrogen atom in the piperidine ring, allowing it to form salts with acids. Its specific characteristics, such as melting point, boiling point, and spectral data, would depend on the purity and specific conditions under which it is studied. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.

Formula: C₈H₁₄ClN

InChI: InChI=1S/C8H13N.ClH/c1-2-7(1)8-3-5-9-6-4-8;/h9H,1-6H2;1H

InChI key: InChIKey=WQCDZZKMLHQOEL-UHFFFAOYSA-N

SMILES: C1(CC1)=C2CCNCC2.Cl

Synonyms:

• Piperidine, 4-cyclopropylidene-, hydrochloride (1:1)
• 4-cyclopropylidenepiperidine hydrochloride