CAS 1949816-59-4

3(2H)-Benzothiazoleacetic acid, 2-imino-5,7-dimethyl-, methyl ester, hydrobromide (1:1)

Description:

3(2H)-Benzothiazoleacetic acid, 2-imino-5,7-dimethyl-, methyl ester, hydrobromide (1:1) is a chemical compound characterized by its unique structure, which includes a benzothiazole moiety and an acetic acid derivative. This compound typically exhibits properties associated with both the benzothiazole and acetic acid functional groups, such as potential biological activity and solubility in polar solvents. The presence of the methyl ester group suggests that it may have a degree of lipophilicity, which can influence its absorption and distribution in biological systems. The hydrobromide salt form indicates that it is likely to be more stable and soluble in aqueous environments, making it suitable for various applications, including pharmaceutical formulations. Additionally, the presence of the imino group may impart specific reactivity or interaction capabilities, potentially enhancing its utility in medicinal chemistry. Overall, this compound's characteristics make it a subject of interest for further research, particularly in the fields of drug development and synthetic chemistry.

Formula: C₁₂H₁₄N₂O₂S·BrH

InChI: InChI=1S/C12H14N2O2S.BrH/c1-7-4-8(2)11-9(5-7)14(12(13)17-11)6-10(15)16-3;/h4-5,13H,6H2,1-3H3;1H

InChI key: InChIKey=BDHFWNVIHQCFIW-UHFFFAOYSA-N

SMILES: C(C(OC)=O)N1C=2C(SC1=N)=C(C)C=C(C)C2.Br

Synonyms:

• 3(2H)-Benzothiazoleacetic acid, 2-imino-5,7-dimethyl-, methyl ester, hydrobromide (1:1)

methyl 2-(2-imino-5,7-dimethylbenzo[d]thiazol-3(2H)-yl)acetate hydrobromide

CAS: 1949816-59-4

Formula: C₁₂H₁₅BrN₂O₂S

Purity: 95.0%

Molecular weight: 331.23

Ref: 10-F515269