CAS 1949836-93-4

N-[2,6-Dinitro-4-(trifluoromethyl)phenyl]glycine 1-methylethyl ester

Description:

N-[2,6-Dinitro-4-(trifluoromethyl)phenyl]glycine 1-methylethyl ester is a chemical compound characterized by its complex structure, which includes a glycine moiety and a substituted aromatic ring. The presence of two nitro groups and a trifluoromethyl group on the phenyl ring contributes to its unique reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The ester functional group indicates that it can undergo hydrolysis, making it relevant in studies of ester reactivity and stability. This compound may exhibit significant biological activity due to the presence of the dinitro and trifluoromethyl substituents, which can influence its interaction with biological targets. Additionally, the compound's molecular weight, solubility, and stability under different conditions are important characteristics that determine its practical applications. Safety and handling considerations are crucial, given the presence of nitro groups, which can pose hazards. Overall, this compound represents a class of chemicals with potential utility in research and industry, warranting further investigation into its properties and applications.

Formula: C₁₂H₁₂F₃N₃O₆

InChI: InChI=1S/C12H12F3N3O6/c1-6(2)24-10(19)5-16-11-8(17(20)21)3-7(12(13,14)15)4-9(11)18(22)23/h3-4,6,16H,5H2,1-2H3

InChI key: InChIKey=QHPSFQQASBMXOE-UHFFFAOYSA-N

SMILES: N(CC(OC(C)C)=O)C1=C(N(=O)=O)C=C(C(F)(F)F)C=C1N(=O)=O

Synonyms:

• N-[2,6-Dinitro-4-(trifluoromethyl)phenyl]glycine 1-methylethyl ester
• Glycine, N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-, 1-methylethyl ester

Propan-2-yl 2-{[2,6-dinitro-4-(trifluoromethyl)-phenyl]amino}acetate

CAS: 1949836-93-4

Versatile small molecule scaffold

Formula: C₁₂H₁₂F₃N₃O₆

Purity: Min. 95%

Molecular weight: 351.24 g/mol

Ref: 3D-ZCD83693