CymitQuimica logo

CAS 194984-24-2

:

N-(1-Cyanocyclopentyl)pentanamide

Description:
N-(1-Cyanocyclopentyl)pentanamide is an organic compound characterized by its amide functional group, which is linked to a pentane chain and a cyanocyclopentyl substituent. The presence of the cyanide group (–C≡N) indicates potential reactivity and polarity, contributing to the compound's solubility in polar solvents. The cyclopentyl ring adds a degree of rigidity and can influence the compound's conformational properties. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests it could participate in hydrogen bonding due to the amide group, which may affect its melting and boiling points. Additionally, the presence of both aliphatic and cyclic components in its structure can lead to unique interactions in various chemical environments. As with many cyanide-containing compounds, safety precautions are necessary due to the potential toxicity associated with cyanide groups. Overall, N-(1-Cyanocyclopentyl)pentanamide presents a unique combination of structural features that may be explored for various applications in organic synthesis and medicinal chemistry.
Formula:C11H18N2O
InChI:InChI=1S/C11H18N2O/c1-2-3-6-10(14)13-11(9-12)7-4-5-8-11/h2-8H2,1H3,(H,13,14)
InChI key:InChIKey=PJYSXZCTXNJKHW-UHFFFAOYSA-N
SMILES:N(C(CCCC)=O)C1(C#N)CCCC1
Synonyms:
  • Pentanamide, N-(1-cyanocyclopentyl)-
  • N-(1-Cyanocyclopentyl)pentanamide
  • 1-Cyano-1-n-pentanoylaminocyclopentane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.