CAS 19504-77-9

Pecilocin

Description:

Pecilocin, with the CAS number 19504-77-9, is a chemical compound that belongs to the class of alkaloids, specifically derived from certain fungal species. It is known for its potential biological activities, including antimicrobial and antifungal properties. Pecilocin exhibits a complex molecular structure, which contributes to its unique pharmacological effects. The compound is typically characterized by its solubility in organic solvents, while its stability can vary depending on environmental conditions such as pH and temperature. In research contexts, pecilocin has garnered interest for its potential applications in medicine and agriculture, particularly in the development of new therapeutic agents. However, detailed studies on its mechanism of action and efficacy are still ongoing. As with many alkaloids, safety and toxicity profiles are essential considerations for its use, necessitating thorough evaluation in both laboratory and clinical settings. Overall, pecilocin represents a fascinating area of study within natural product chemistry and pharmacology.

Formula: C₁₇H₂₅NO₃

InChI: InChI=1S/C17H25NO3/c1-3-4-9-15(19)13-14(2)8-5-6-10-16(20)18-12-7-11-17(18)21/h5-6,8,10,13,15,19H,3-4,7,9,11-12H2,1-2H3/b8-5+,10-6+,14-13+/t15-/m1/s1

InChI key: InChIKey=ZYPGADGCNXOUJP-CXVPHVKISA-N

SMILES: C(/C=C/C=C/C(=C/[C@@H](CCCC)O)/C)(=O)N1C(=O)CCC1

Synonyms:

• 1-[(2E,4E,6E,8R)-8-Hydroxy-6-methyl-1-oxo-2,4,6-dodecatrien-1-yl]-2-pyrrolidinone
• 2-Pyrrolidinone, 1-[(2E,4E,6E,8R)-8-hydroxy-6-methyl-1-oxo-2,4,6-dodecatrienyl]-
• 2-Pyrrolidinone, 1-(8-hydroxy-6-methyl-2,4,6-dodecatrienoyl)-, (E,E,E)-(R)-
• 2-Pyrrolidinone, 1-(8-hydroxy-6-methyl-1-oxo-2,4,6-dodecatrienyl)-, [R-(E,E,E)]-
• 2-Pyrrolidinone, 1-[(2E,4E,6E,8R)-8-hydroxy-6-methyl-1-oxo-2,4,6-dodecatrien-1-yl]-

Pecilocin

CAS: 19504-77-9

Pecilocin is a fungicidal antibiotic generated by Paecilomyces varioti Bainier var. antibioticus.

Formula: C₁₇H₂₅NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 291.391

Ref: TM-T25926