CAS 195053-92-0

2-(1-TRITYL-1H-IMIDAZOL-4-YL)-ETHYLAMINE HYDRATE

Description:

2-(1-Trityl-1H-imidazol-4-yl)-ethylamine hydrate is a chemical compound characterized by its imidazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of the trityl group, a bulky phenyl-based substituent, enhances the compound's stability and solubility in organic solvents. This compound typically exists as a hydrate, indicating that it can form hydrogen bonds with water molecules, which may influence its solubility and reactivity. The ethylamine moiety contributes to its basicity and potential for forming salts with acids. In terms of applications, compounds like this are often explored in medicinal chemistry for their potential roles as pharmaceuticals, particularly in the development of drugs targeting various biological pathways. The specific properties, such as melting point, solubility, and reactivity, would depend on the conditions under which the compound is studied. Overall, 2-(1-trityl-1H-imidazol-4-yl)-ethylamine hydrate represents a versatile structure with potential implications in drug design and synthesis.

Formula: C₂₄H₂₃N₃

InChI: InChI=1/C24H23N3/c25-17-16-23-18-27(19-26-23)24(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-15,18-19H,16-17,25H2

SMILES: c1ccc(cc1)C(c1ccccc1)(c1ccccc1)n1cc(CCN)nc1

Synonyms:

• 2-(1-Trityl-1H-Imidazol-4-Yl)-Ethylamine
• 2-(1-trityl-1H-imidazol-4-yl)ethanamine
• 1-(triphenylmethyl)-1H-Imidazole-4-ethanamine

2-(1-Trityl-1H-imidazol-4-yl)ethanamine

CAS: 195053-92-0

Formula: C₂₄H₂₃N₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 353.4595

Ref: IN-DA007RE4

2-(1-Trityl-1H-imidazol-4-yl)ethanamine

CAS: 195053-92-0

2-(1-Trityl-1H-imidazol-4-yl)ethanamine

Purity: 98%

Molecular weight: 353.46g/mol

Ref: 54-OR91156

2-(1-Trityl-1H-imidazol-4-yl)ethanamine

CAS: 195053-92-0

Purity: 98%

Molecular weight: 353.468994140625

Ref: 10-F790832

2-(1-Trityl-1H-imidazol-4-yl)-ethylamine

CAS: 195053-92-0

2-(1-Trityl-1H-imidazol-4-yl)-ethylamine is a histamine receptor antagonist. It has been shown to inhibit the release of histamines from mast cells, which are responsible for allergic reactions and other inflammatory responses. 2-(1-Trityl-1H-imidazol-4-yl)-ethylamine also inhibits the production of inflammatory cytokines such as ILs and TNFs. This drug has been shown to be selective in its inhibition of histamine receptors, with little effect on other receptors or ion channels.

Formula: C₂₄H₂₃N₃

Purity: Min. 95%

Molecular weight: 353.47 g/mol

Ref: 3D-VHA05392