CAS 1951-26-4: (2-Butyl-3-benzofuranyl)(4-hydroxy-3,5-diiodophenyl)methanone
Description:The chemical substance known as (2-Butyl-3-benzofuranyl)(4-hydroxy-3,5-diiodophenyl)methanone, with the CAS number 1951-26-4, is a complex organic compound characterized by its unique structural features. It contains a benzofuran moiety, which contributes to its aromatic properties, and a butyl group that enhances its hydrophobic characteristics. The presence of a methanone functional group indicates that it is a ketone, which can influence its reactivity and interactions with other molecules. Additionally, the compound features a diiodophenyl group, which suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with iodine-containing compounds. The hydroxyl group on the phenyl ring may also impart additional reactivity and solubility characteristics. Overall, this compound's structural complexity and functional groups suggest it could exhibit interesting chemical behavior and potential applications in various fields, including organic synthesis and drug development.
Formula:C19H16I2O3
InChI:InChI=1S/C19H16I2O3/c1-2-3-7-16-17(12-6-4-5-8-15(12)24-16)18(22)11-9-13(20)19(23)14(21)10-11/h4-6,8-10,23H,2-3,7H2,1H3
InChI key:InChIKey=PNFMEGSMKIHDFZ-UHFFFAOYSA-N
SMILES:O=C(C1=CC(I)=C(O)C(I)=C1)C=2C=3C=CC=CC3OC2CCCC
- Synonyms:
- (2-Butyl-1-Benzofuran-3-Yl)(4-Hydroxy-3,5-Diiodophenyl)Methanone
- (2-Butyl-3-benzofuranyl)(4-hydroxy-3,5-diiodophenyl)-methanone
- 2-Butyl-3-(3',5-Diiodo-4-Hydroxybensoyl)-Benzofuran
- 2-Butyl-3-(3,5-Diiodo-4-Hydroxybenzoyl) Benzofuran
- 2-Butyl-3-(3,5-diiodo-4-hydroxy benzoyl) benzofurane
- 2-Butyl-3-(3,5-diiodo-4-hydroxy benzoyl)benzofuran
- 2-Butyl-3-benzofuranyl 4-hydroxy-3,5-diiodophenyl ketone
- Ketone, 2-butyl-3-benzofuranyl 4-hydroxy-3,5-diiodophenyl
- L 3373
- Methanone, (2-butyl-3-benzofuranyl)(4-hydroxy-3,5-diiodophenyl)-
- See more synonyms
- NSC 85437
- S 1086
