CymitQuimica logo

CAS 195131-60-3

:

2-[4-[2-[[[(4-Fluorophenyl)amino]carbonyl]heptylamino]ethyl]phenoxy]-2-methylpropanoic acid

Description:
The chemical substance known as 2-[4-[2-[[[(4-Fluorophenyl)amino]carbonyl]heptylamino]ethyl]phenoxy]-2-methylpropanoic acid, with the CAS number 195131-60-3, is a complex organic compound characterized by its multi-functional structure. It features a phenoxy group, which is indicative of its potential use in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of a fluorine atom in the para position of the phenyl ring may enhance its biological activity and lipophilicity. The heptylamino chain suggests that the compound has a significant hydrophobic character, which could influence its solubility and permeability in biological systems. Additionally, the carboxylic acid functional group contributes to its acidity and potential interactions with biological targets. Overall, this compound's unique structural features may confer specific pharmacological properties, making it a candidate for further investigation in drug development or therapeutic applications.
Formula:C26H35FN2O4
InChI:InChI=1S/C26H35FN2O4/c1-4-5-6-7-8-18-29(25(32)28-22-13-11-21(27)12-14-22)19-17-20-9-15-23(16-10-20)33-26(2,3)24(30)31/h9-16H,4-8,17-19H2,1-3H3,(H,28,32)(H,30,31)
InChI key:InChIKey=JZVKMPJMTAXOBC-UHFFFAOYSA-N
SMILES:N(C(NC1=CC=C(F)C=C1)=O)(CCC2=CC=C(OC(C(O)=O)(C)C)C=C2)CCCCCCC
Synonyms:
  • Propanoic acid, 2-[4-[2-[[[(4-fluorophenyl)amino]carbonyl]heptylamino]ethyl]phenoxy]-2-methyl-
  • 2-[4-[2-[[[(4-Fluorophenyl)amino]carbonyl]heptylamino]ethyl]phenoxy]-2-methylpropanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.