CAS 1951438-92-8

1,3,4-Thiadiazole-2-methanol, 5-[4-fluoro-2-(trifluoromethyl)phenyl]-, 2-acetate

Description:

1,3,4-Thiadiazole-2-methanol, 5-[4-fluoro-2-(trifluoromethyl)phenyl]-, 2-acetate is a chemical compound characterized by its unique structure, which includes a thiadiazole ring, a methanol group, and an acetate moiety. The presence of a trifluoromethyl group and a fluorine atom on the phenyl ring contributes to its potential biological activity and lipophilicity. This compound may exhibit properties such as antimicrobial, antifungal, or anti-inflammatory activities, making it of interest in pharmaceutical research. Its molecular structure suggests it could participate in various chemical reactions, including esterification and nucleophilic substitutions. The thiadiazole ring is known for its stability and ability to form coordination complexes, which may enhance its reactivity. Additionally, the presence of multiple fluorine atoms can influence the compound's solubility and metabolic stability. Overall, this compound's characteristics make it a subject of interest for further studies in medicinal chemistry and drug development.

Formula: C₁₂H₈F₄N₂O₂S

InChI: InChI=1S/C12H8F4N2O2S/c1-6(19)20-5-10-17-18-11(21-10)8-3-2-7(13)4-9(8)12(14,15)16/h2-4H,5H2,1H3

InChI key: InChIKey=IHHHFHVJIRNJEG-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(C=CC(F)=C1)C=2SC(COC(C)=O)=NN2

Synonyms:

• 1,3,4-Thiadiazole-2-methanol, 5-[4-fluoro-2-(trifluoromethyl)phenyl]-, 2-acetate

(5-(4-Fluoro-2-(trifluoromethyl)phenyl)-1,3,4-thiadiazol-2-yl)methyl acetate

CAS: 1951438-92-8

Formula: C₁₂H₈F₄N₂O₂S

Purity: 95.0%

Molecular weight: 320.26

Ref: 10-F432986