CAS 1951439-23-8

1H-Imidazole, 5-bromo-4-(trifluoromethyl)-1-[[2-(trimethylsilyl)ethoxy]methyl]-

Description:

1H-Imidazole, 5-bromo-4-(trifluoromethyl)-1-[[2-(trimethylsilyl)ethoxy]methyl]- is a complex organic compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a bromine atom at the 5-position and a trifluoromethyl group at the 4-position introduces significant electronegative characteristics, influencing the compound's reactivity and polarity. The trimethylsilyl group enhances the compound's stability and solubility in organic solvents, while the ethoxy group contributes to its overall hydrophobicity. This compound may exhibit interesting biological activities due to its structural features, making it a potential candidate for pharmaceutical applications. Its synthesis and manipulation require careful handling due to the presence of halogen and silyl groups, which can affect its reactivity. Overall, this compound exemplifies the complexity and versatility of modern organic chemistry, particularly in the design of molecules with specific functional properties.

Formula: C₁₀H₁₆BrF₃N₂OSi

InChI: InChI=1S/C10H16BrF3N2OSi/c1-18(2,3)5-4-17-7-16-6-15-8(9(16)11)10(12,13)14/h6H,4-5,7H2,1-3H3

InChI key: InChIKey=KOHSMPVYZCEDNR-UHFFFAOYSA-N

SMILES: C(OCC[Si](C)(C)C)N1C(Br)=C(C(F)(F)F)N=C1

Synonyms:

• 1H-Imidazole, 5-bromo-4-(trifluoromethyl)-1-[[2-(trimethylsilyl)ethoxy]methyl]-
• 5-Bromo-4-(trifluoromethyl)-1-[[2-(trimethylsilyl)ethoxy]methyl]-1H-imidazole

5-BROMO-4-(TRIFLUOROMETHYL)-1-((2-(TRIMETHYLSILYL)ETHOXY)METHYL)-1H-IMIDAZOLE

CAS: 1951439-23-8

Formula: C₁₀H₁₆BrF₃N₂OSi

Purity: 95.0%

Molecular weight: 345.235

Ref: 10-F469856