CAS 1951439-34-1

1H-Indole, 3-(3-azetidinyl)-, hydrochloride (1:1)

Description:

1H-Indole, 3-(3-azetidinyl)-, hydrochloride (1:1) is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of the azetidine moiety introduces a four-membered saturated nitrogen-containing ring, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its potential applications in biological systems. This compound may exhibit pharmacological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could lead to various therapeutic effects. The compound's stability, solubility, and reactivity can be influenced by the presence of the hydrochloride group, which can also affect its bioavailability and pharmacokinetics. Overall, 1H-Indole, 3-(3-azetidinyl)-, hydrochloride (1:1) represents a class of compounds that may have significant implications in pharmaceutical research and development.

Formula: C₁₁H₁₂N₂·ClH

InChI: InChI=1S/C11H12N2.ClH/c1-2-4-11-9(3-1)10(7-13-11)8-5-12-6-8;/h1-4,7-8,12-13H,5-6H2;1H

InChI key: InChIKey=XPVRGQVYLWYZLD-UHFFFAOYSA-N

SMILES: C=1(C=2C(NC1)=CC=CC2)C3CNC3.Cl

Synonyms:

• 1H-Indole, 3-(3-azetidinyl)-, hydrochloride (1:1)

3-(Azetidin-3-yl)-1h-indole hcl

CAS: 1951439-34-1

Formula: C₁₁H₁₃ClN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 208.6873

Ref: IN-DA00I35P

3-(Azetidin-3-yl)-1H-indole hydrochloride

CAS: 1951439-34-1

3-(Azetidin-3-yl)-1H-indole hydrochloride

Purity: 97%

Molecular weight: 208.69g/mol

Ref: 54-OR1055064

3-(AZETIDIN-3-YL)-1H-INDOLE HCL

CAS: 1951439-34-1

Purity: 95.0%

Molecular weight: 208.69000244140625

Ref: 10-F472194