CAS 1951439-46-5
:1,1-Dimethylethyl 3,6,9,12-tetraoxa-2-azapentadec-14-ynoate
Description:
1,1-Dimethylethyl 3,6,9,12-tetraoxa-2-azapentadec-14-ynoate, identified by its CAS number 1951439-46-5, is a chemical compound that features a complex structure characterized by the presence of multiple functional groups, including ester and azole moieties. This compound is likely to exhibit properties typical of esters, such as being relatively non-polar and having moderate solubility in organic solvents. The presence of the tetraoxa and azapentadecane components suggests that it may have interesting reactivity and stability profiles, potentially making it useful in various applications, including pharmaceuticals or materials science. Its molecular structure indicates that it may participate in hydrogen bonding due to the presence of oxygen atoms, which could influence its physical properties, such as boiling and melting points. Additionally, the dimethyl group may contribute to steric hindrance, affecting its reactivity and interactions with other molecules. Overall, this compound's unique characteristics stem from its intricate arrangement of atoms and functional groups, which can lead to diverse chemical behavior.
Formula:C14H25NO6
InChI:InChI=1S/C14H25NO6/c1-5-6-17-7-8-18-9-10-19-11-12-20-15-13(16)21-14(2,3)4/h1H,6-12H2,2-4H3,(H,15,16)
InChI key:InChIKey=VMOMFXUHEJCHQS-UHFFFAOYSA-N
SMILES:N(OCCOCCOCCOCC#C)C(OC(C)(C)C)=O
Synonyms:- 1,1-Dimethylethyl 3,6,9,12-tetraoxa-2-azapentadec-14-ynoate
- 3,6,9,12-Tetraoxa-2-azapentadec-14-ynoic acid, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3,6,9,12-Tetraoxa-2-azapentadec-14-ynoic acid, 1,1-dimethylethyl ester
CAS:Formula:C14H25NO6Molecular weight:303.3514t-Boc-aminooxy-PEG3-propargyl
CAS:t-Boc-aminooxy-PEG3-propargyl is a linker with propargyl and t-Boc-aminooxy for antibody-drug conjugate development.Formula:C14H25NO6Color and Shape:SolidMolecular weight:303.35

