CAS 1951441-01-2

Imidazo[1,2-a]pyrazine, 3-(3-chlorophenyl)-5,6,7,8-tetrahydro-, hydrochloride (1:1)

Description:

Imidazo[1,2-a]pyrazine, 3-(3-chlorophenyl)-5,6,7,8-tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure, which includes an imidazo and pyrazine moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, making it of interest in medicinal chemistry. The presence of the 3-chlorophenyl group suggests that it may have specific interactions with biological targets, potentially influencing its pharmacological profile. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, which can enhance its bioavailability. The compound's molecular structure may confer various physical properties, including melting point, solubility, and stability, which are essential for its application in research or therapeutic contexts. Additionally, the compound's CAS number, 1951441-01-2, allows for precise identification and retrieval of information regarding its synthesis, safety data, and regulatory status. Overall, this compound represents a significant area of interest for further exploration in drug development and related fields.

Formula: C₁₂H₁₂ClN₃·ClH

InChI: InChI=1S/C12H12ClN3.ClH/c13-10-3-1-2-9(6-10)11-7-15-12-8-14-4-5-16(11)12;/h1-3,6-7,14H,4-5,8H2;1H

InChI key: InChIKey=KYQMZKBLCYREPL-UHFFFAOYSA-N

SMILES: ClC=1C=C(C=2N3C(=NC2)CNCC3)C=CC1.Cl

Synonyms:

• Imidazo[1,2-a]pyrazine, 3-(3-chlorophenyl)-5,6,7,8-tetrahydro-, hydrochloride (1:1)

3-(3-CHLOROPHENYL)-5,6,7,8-TETRAHYDROIMIDAZO[1,2-A]PYRAZINE HCL

CAS: 1951441-01-2

Formula: C₁₂H₁₃Cl₂N₃

Purity: 95.0%

Molecular weight: 270.16

Ref: 10-F387828