CAS 1951441-79-4

3-Pyridinepropanamine, 5-(trifluoromethyl)-, hydrochloride (1:1)

Description:

3-Pyridinepropanamine, 5-(trifluoromethyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a trifluoromethyl group (-CF3) at the 5-position of the pyridine enhances its lipophilicity and may influence its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. This compound may exhibit properties such as basicity due to the amine functional group, allowing it to participate in protonation reactions. Its unique structure suggests potential uses in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. Additionally, the trifluoromethyl group is known to impart metabolic stability and can modulate the compound's interaction with biological targets. Overall, 3-Pyridinepropanamine, 5-(trifluoromethyl)-, hydrochloride is a compound of interest in both synthetic and medicinal chemistry contexts.

Formula: C₉H₁₁F₃N₂·ClH

InChI: InChI=1S/C9H11F3N2.ClH/c10-9(11,12)8-4-7(2-1-3-13)5-14-6-8;/h4-6H,1-3,13H2;1H

InChI key: InChIKey=FQXUDPACLCERLF-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C(CCCN)C=NC1.Cl

Synonyms:

• 3-Pyridinepropanamine, 5-(trifluoromethyl)-, hydrochloride (1:1)

3-[5-(Trifluoromethyl)pyridin-3-yl]propylamine hydrochloride

CAS: 1951441-79-4

Formula: C₉H₁₂ClF₃N₂

Purity: 95.0%

Molecular weight: 240.65

Ref: 10-F469700