CAS 1951442-15-1: 4-(5-Bromo-1H-indol-3-yl)-3-cyclohexen-1-one

Description:4-(5-Bromo-1H-indol-3-yl)-3-cyclohexen-1-one is a chemical compound characterized by its unique structure, which includes an indole moiety substituted with a bromine atom and a cyclohexenone framework. The presence of the bromine atom enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The cyclohexenone part of the molecule contributes to its potential as a reactive electrophile, which may participate in various chemical reactions, including Michael additions and cycloadditions. This compound may exhibit interesting properties such as fluorescence or photochemical activity due to the conjugated systems present in its structure. Additionally, its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature. Overall, 4-(5-Bromo-1H-indol-3-yl)-3-cyclohexen-1-one represents a versatile scaffold for further chemical exploration and potential therapeutic applications.

Formula:C₁₄H₁₂BrNO

InChI:InChI=1S/C14H12BrNO/c15-10-3-6-14-12(7-10)13(8-16-14)9-1-4-11(17)5-2-9/h1,3,6-8,16H,2,4-5H2

InChI key:InChIKey=BSJGMUTZCBIUCY-UHFFFAOYSA-N

SMILES:O=C1CC=C(C2=CNC=3C=CC(Br)=CC32)CC1