CAS 1951466-83-3

1-[9-[(4-Bromophenyl)methyl]-1,3,4,9-tetrahydro-2H-pyrido[3,4-b]indol-2-yl]-2-(1-pyrrolidinyl)ethanone

Description:

1-[9-[(4-Bromophenyl)methyl]-1,3,4,9-tetrahydro-2H-pyrido[3,4-b]indol-2-yl]-2-(1-pyrrolidinyl)ethanone, with CAS number 1951466-83-3, is a complex organic compound characterized by its unique structural features, including a pyridoindole framework and a pyrrolidine moiety. This compound typically exhibits properties associated with its heterocyclic structure, such as potential biological activity, which may include interactions with neurotransmitter systems or other cellular targets. The presence of the bromophenyl group suggests that it may have enhanced lipophilicity, potentially influencing its pharmacokinetic properties. Additionally, the tetrahydro configuration indicates that it may exist in multiple conformations, which could affect its reactivity and binding affinity in biological systems. As with many compounds of this nature, its solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent. Overall, this compound represents a class of molecules that may be of interest in medicinal chemistry and drug development, particularly in the context of neuropharmacology.

Formula: C₂₄H₂₆BrN₃O

InChI: InChI=1S/C24H26BrN3O/c25-19-9-7-18(8-10-19)15-28-22-6-2-1-5-20(22)21-11-14-27(16-23(21)28)24(29)17-26-12-3-4-13-26/h1-2,5-10H,3-4,11-17H2

InChI key: InChIKey=WIRUYQFUVBBWPT-UHFFFAOYSA-N

SMILES: C(N1C2=C(C=3C1=CC=CC3)CCN(C(CN4CCCC4)=O)C2)C5=CC=C(Br)C=C5

Synonyms:

• Ethanone, 1-[9-[(4-bromophenyl)methyl]-1,3,4,9-tetrahydro-2H-pyrido[3,4-b]indol-2-yl]-2-(1-pyrrolidinyl)-
• 1-[9-[(4-Bromophenyl)methyl]-1,3,4,9-tetrahydro-2H-pyrido[3,4-b]indol-2-yl]-2-(1-pyrrolidinyl)ethanone
• YF-452

YF-452

CAS: 1951466-83-3

YF-452 inhibits tumor growth through antiangiogenesis by suppressing VEGF receptor 2 signaling.

Formula: C₂₄H₂₆BrN₃O

Purity: 98%

Color and Shape: Solid

Molecular weight: 452.39

Ref: TM-T29173