CAS 19518-26-4

3-Picolinium, 1-(2-benzoylvinyl)-, chloride, (E)-

Description:

3-Picolinium, 1-(2-benzoylvinyl)-, chloride, (E)- is a chemical compound characterized by its unique structure, which includes a pyridine ring and a vinyl group substituted with a benzoyl moiety. This compound typically appears as a solid or crystalline substance and is known for its potential applications in organic synthesis and medicinal chemistry. The presence of the picolinium ion suggests that it may exhibit properties associated with quaternary ammonium compounds, such as antimicrobial activity or the ability to act as a surfactant. The (E)- configuration indicates that the compound has a specific geometric arrangement around the double bond, which can influence its reactivity and interaction with biological targets. As with many organic compounds, its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Safety data should be consulted for handling and usage, as the chloride component may impart certain hazards typical of halogenated compounds. Overall, this compound represents an interesting area of study within the field of organic chemistry.

Formula: C₁₅H₁₄NO·Cl

InChI: InChI=1S/C15H14NO.ClH/c1-13-6-5-10-16(12-13)11-9-15(17)14-7-3-2-4-8-14;/h2-12H,1H3;1H/q+1;/p-1/b11-9+;

InChI key: InChIKey=DOOXBWBAALWZCH-LBEJWNQZSA-M

SMILES: C(/C=C/[N+]=1C=C(C)C=CC1)(=O)C2=CC=CC=C2.[Cl-]

Synonyms:

• 3-Picolinium, 1-(2-benzoylvinyl)-, chloride, (E)-

3-Methyl-N-[(1E)-3-oxo-3-phenylprop-1-en-1-yl]pyridinium chloride

CAS: 19518-26-4

3-Methyl-N-[(1E)-3-oxo-3-phenylprop-1-en-1-yl]pyridinium chloride

Purity: ≥95%

Color and Shape: Powder

Molecular weight: 259.73g/mol

Ref: 54-OR22247