CAS 19525-87-2: Benzylserinemethylester hydrochloride

Description:Benzylserinemethylester hydrochloride is a chemical compound that serves as a derivative of serine, an amino acid. It is characterized by the presence of a benzyl group attached to the serine structure, along with a methyl ester functional group. The hydrochloride form indicates that the compound is a salt, which enhances its solubility in water and makes it more stable for various applications. This compound is often utilized in biochemical research and pharmaceutical development due to its potential role in peptide synthesis and as a building block for more complex molecules. Its properties include being a white to off-white crystalline solid, with a specific melting point range and solubility in polar solvents. The presence of the ester group allows for reactivity in organic synthesis, while the amino acid backbone contributes to its biological relevance. As with many chemical substances, proper handling and safety precautions are essential, as it may exhibit specific biological activities or effects that require careful study.

Formula:C₁₁H₁₅NO₃

InChI:InChI=1/C11H15NO3/c1-14-11(13)10(12)8-15-7-9-5-3-2-4-6-9/h2-6,10H,7-8,12H2,1H3

Synonyms:
O-Benzyl-L-serine methyl ester hydrochloride
methyl O-benzylserinate
H-Ser(Bzl)-OMe・HCl

Found 5 products.

Product data	Purity	Price range	Estimated delivery
O-Benzyl-L-serine Methyl Ester Hydrochloride REF: 3B-B1450CAS: 19525-87-2	>98.0%(T)	75.00 €~228.00 €	Mon 07 Apr 25
O-BENZYL-L-SERINE METHYL ESTER HYDROCHLORIDE REF: IN-DA003TFSCAS: 19525-87-2	97%	26.00 €~501.00 €	Mon 14 Apr 25
H-Ser(Bzl)-Ome.Hcl REF: 54-OR1013530CAS: 19525-87-2	99%	32.00 €~719.00 €	Tue 15 Apr 25
H-Ser(Bzl)-OMe.HCl REF: 10-M06059CAS: 19525-87-2	95%	To inquire	Thu 24 Apr 25
O-Benzyl-L-serine methyl ester hydrochloride REF: 3D-FB50520CAS: 19525-87-2	Min. 95%	- - -	Discontinued product