CymitQuimica logo

CAS 195252-56-3

:

4,5-Pyrimidinediamine,6-chloro-N4-propyl-

Description:
4,5-Pyrimidinediamine, 6-chloro-N4-propyl- is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at the 4 and 5 positions. The presence of a chlorine atom at the 6 position and a propyl group attached to the nitrogen at the N4 position are notable features that influence its chemical reactivity and potential applications. This compound is typically classified as an amine due to the presence of amino groups (-NH2) at the 4 and 5 positions of the pyrimidine ring. Its molecular structure suggests potential uses in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. The compound may exhibit properties such as solubility in polar solvents, and its reactivity can be influenced by the electron-withdrawing nature of the chlorine substituent. Safety and handling precautions should be observed, as with many nitrogen-containing heterocycles, due to potential toxicity or reactivity.
Formula:C7H11ClN4
InChI:InChI=1S/C7H11ClN4/c1-2-3-10-7-5(9)6(8)11-4-12-7/h4H,2-3,9H2,1H3,(H,10,11,12)
InChI key:GYPKKOOUKYMZRZ-UHFFFAOYSA-N
SMILES:CCCNC1=C(C(=NC=N1)Cl)N
Synonyms:
  • 5-Amino-6-chloro-4-(propylamino)pyrimidine
  • 6-Chloro-N4-propyl-4,5-pyrimidinediamine
Found 4 products.