CymitQuimica logo

CAS 19526-09-1

:

Frangufoline

Description:
Frangufoline, with the CAS number 19526-09-1, is a chemical compound that belongs to the class of alkaloids, which are naturally occurring organic compounds that mostly contain basic nitrogen atoms. This substance is primarily derived from certain plant species, particularly those in the genus *Frangula*. Frangufoline is known for its potential pharmacological properties, including anti-inflammatory and analgesic effects, which have been the subject of various studies. The compound typically exhibits a complex molecular structure, characterized by multiple functional groups that contribute to its biological activity. Its solubility and stability can vary depending on the solvent and environmental conditions. As with many alkaloids, frangufoline may also exhibit toxicity at certain concentrations, necessitating careful handling and usage in research and potential therapeutic applications. Further studies are often required to fully elucidate its mechanisms of action and potential therapeutic benefits.
Formula:C31H42N4O4
InChI:InChI=1S/C31H42N4O4/c1-20(2)18-25-29(36)32-17-16-22-12-14-24(15-13-22)39-28(21(3)4)27(31(38)33-25)34-30(37)26(35(5)6)19-23-10-8-7-9-11-23/h7-17,20-21,25-28H,18-19H2,1-6H3,(H,32,36)(H,33,38)(H,34,37)/b17-16-/t25-,26-,27-,28-/m0/s1
InChI key:InChIKey=TVUQUDJOLFMOKT-SPZUWTHGSA-N
SMILES:N(C([C@H](CC1=CC=CC=C1)N(C)C)=O)[C@H]2[C@H](C(C)C)OC=3C=CC(=CC3)/C=C\NC(=O)[C@H](CC(C)C)NC2=O
Synonyms:
  • L-Leucinamide, N,N-dimethyl-L-phenylalanyl-(3S)-3-hydroxy-L-leucyl-N-[(1Z)-2-(4-hydroxyphenyl)ethenyl]-, cyclic (2→3)-ether
  • Sanjoinine A
  • Benzenepropanamide, α-(dimethylamino)-N-[3-(1-methylethyl)-7-(2-methylpropyl)-5,8-dioxo-2-oxa-6,9-diazabicyclo[10.2.2]hexadeca-10,12,14,15-tetraen-4-yl]-, [3S-[3R*,4R*(R*),7R*]]-
  • 2-Oxa-6,9-diazabicyclo[10.2.2]hexadecane, benzenepropanamide deriv.
  • Frangufoline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.