CAS 19532-73-1

N,N'-BIS(2-HYDROXYPHENYL)ETHANEDIAMIDE

Description:

N,N'-Bis(2-hydroxyphenyl)ethanediamide, also known by its CAS number 19532-73-1, is an organic compound characterized by its dual hydroxyl-substituted phenyl groups attached to an ethanediamide backbone. This compound typically exhibits properties such as solubility in organic solvents and moderate stability under standard conditions. It is known for its potential applications in various fields, including pharmaceuticals and materials science, due to its ability to form chelates with metal ions, which can enhance the efficacy of certain drugs or act as catalysts in chemical reactions. The presence of hydroxyl groups contributes to its hydrogen bonding capabilities, influencing its reactivity and interaction with other substances. Additionally, the compound may exhibit antioxidant properties, making it of interest in biological and environmental studies. Overall, N,N'-bis(2-hydroxyphenyl)ethanediamide is a versatile compound with significant implications in both research and industrial applications.

Formula: C₁₄H₁₂N₂O₄

InChI: InChI=1/C14H12N2O4/c17-11-7-3-1-5-9(11)15-13(19)14(20)16-10-6-2-4-8-12(10)18/h1-8,17-18H,(H,15,19)(H,16,20)

SMILES: c1ccc(c(c1)NC(=O)C(=O)Nc1ccccc1O)O

Synonyms:

• ethanediamide, N~1~,N~2~-bis(2-hydroxyphenyl)-
• N,N'-Bis(2-hydroxyphenyl)ethanediamide

N,N'-bis(2-hydroxyphenyl)ethanediamide

CAS: 19532-73-1

Formula: C₁₄H₁₂N₂O₄

Molecular weight: 272.2561

Ref: IN-DA007RCC

N,N'-Bis(2-hydroxyphenyl)ethanediamide

CAS: 19532-73-1

Versatile small molecule scaffold

Formula: C₁₄H₁₂N₂O₄

Purity: Min. 95%

Molecular weight: 272.26 g/mol

Ref: 3D-UAA53273