CAS 19533-07-4

[4-(oxiran-2-ylmethoxy)phenyl](phenyl)methanone

Description:

The chemical substance known as [4-(oxiran-2-ylmethoxy)phenyl](phenyl)methanone, with the CAS number 19533-07-4, is an organic compound that features a complex structure incorporating both an epoxide group and a ketone functionality. This compound is characterized by its phenyl rings, which contribute to its aromatic properties and potential reactivity. The presence of the oxirane (epoxide) moiety suggests that it may participate in ring-opening reactions, making it useful in various synthetic applications. Additionally, the methoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with other chemical species. The compound's structure indicates potential applications in fields such as materials science, pharmaceuticals, and organic synthesis, where its unique functional groups can be exploited for further chemical transformations. Overall, this compound exemplifies the diverse chemistry associated with substituted phenyl ketones and epoxides, highlighting its potential utility in various chemical contexts.

Formula: C₁₆H₁₄O₃

InChI: InChI=1/C16H14O3/c17-16(12-4-2-1-3-5-12)13-6-8-14(9-7-13)18-10-15-11-19-15/h1-9,15H,10-11H2

SMILES: c1ccc(cc1)C(=O)c1ccc(cc1)OCC1CO1

2-(4-benzoylphenoxymethyl)oxirane

CAS: 19533-07-4

Formula: C₁₆H₁₄O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 254.2806

Ref: IN-DA019JE4

4-Glycidyloxy benzophenone

CAS: 19533-07-4

4-Glycidyloxy benzophenone

Purity: 95%

Molecular weight: 254.28g/mol

Ref: 54-OR72672