CAS 19533-92-7

Alphitolic acid

Description:

Alphitolic acid, with the CAS number 19533-92-7, is a naturally occurring organic compound classified as a phenolic acid. It is primarily derived from the hydrolysis of certain plant materials, particularly those associated with the oak tree. This compound is characterized by its aromatic structure, which includes a hydroxyl group (-OH) attached to a benzene ring, contributing to its chemical reactivity and potential biological activity. Alphitolic acid exhibits antioxidant properties, which may play a role in protecting cells from oxidative stress. Additionally, it has been studied for its potential antimicrobial and anti-inflammatory effects, making it of interest in various fields, including pharmacology and food science. The solubility of alphitolic acid in organic solvents and its stability under certain conditions are important for its applications in research and industry. Overall, alphitolic acid represents a significant compound with potential health benefits and applications in natural product chemistry.

Formula: C₃₀H₄₈O₄

InChI: InChI=1S/C30H48O4/c1-17(2)18-10-13-30(25(33)34)15-14-28(6)19(23(18)30)8-9-22-27(5)16-20(31)24(32)26(3,4)21(27)11-12-29(22,28)7/h18-24,31-32H,1,8-16H2,2-7H3,(H,33,34)/t18-,19+,20+,21-,22+,23+,24-,27-,28+,29+,30-/m0/s1

InChI key: InChIKey=PFCVZKFJHRCLCC-PGOIBATFSA-N

SMILES: C(O)(=O)[C@]12[C@@]([C@@]3([C@@](C)(CC1)[C@@]4(C)[C@](CC3)([C@]5(C)[C@@](CC4)(C(C)(C)[C@@H](O)[C@H](O)C5)[H])[H])[H])([C@H](C(C)=C)CC2)[H]

Synonyms:

• 3aH-Cyclopenta[a]chrysene, lup-20(29)-en-28-oic acid deriv.
• Alphitolic acid
• (2α,3β)-2,3-Dihydroxylup-20(29)-en-28-oic acid
• Lup-20(29)-en-28-oic acid, 2,3-dihydroxy-, (2α,3β)-
• Lup-20(29)-en-28-oic acid, 2α,3β-dihydroxy-

2α,3β-Dihydroxylup-20(29)-en-28-oic acid

CAS: 19533-92-7

Formula: C₃₀H₄₈O₄

Purity: 97.5%

Molecular weight: 472.6997

Ref: IN-DA00AKW0

Alphitolic acid

CAS: 19533-92-7

Alphitolic acid from Potentilla freyniana Bornm is an HMGCS2 inhibitor with anti-inflammatory and anti-cancer activity.

Formula: C₃₀H₄₈O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 472.7

Ref: TM-TN1379

Alphitolic acid

CAS: 19533-92-7

Formula: C₃₀H₄₈O₄

Purity: 95%~99%

Molecular weight: 472.71

Ref: BP-SBP01052

Alphitolic acid

CAS: 19533-92-7

Alphitolic acid is a naturally occurring triterpenoid compound, which is extracted from various plant sources, particularly certain medicinal herbs. Known for its complex structure, this compound functions primarily through its antioxidant activity, effectively neutralizing reactive oxygen species (ROS) and mitigating oxidative stress at a cellular level.

Formula: C₃₀H₄₈O₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 472.7 g/mol

Ref: 3D-UAA53392