CymitQuimica logo

CAS 195371-86-9

:

N1-[2-(2-piperidyl)ethyl]-3,5-di(trifluoromethyl)aniline

Description:
N1-[2-(2-piperidyl)ethyl]-3,5-di(trifluoromethyl)aniline, with the CAS number 195371-86-9, is a chemical compound characterized by its complex structure, which includes a piperidine ring and multiple trifluoromethyl groups. This compound features an aniline moiety, indicating the presence of an amino group attached to an aromatic ring, which contributes to its reactivity and potential applications in various chemical reactions. The trifluoromethyl groups enhance the lipophilicity and metabolic stability of the molecule, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The piperidyl group provides additional steric and electronic properties that can influence the compound's biological activity. Overall, this substance is notable for its potential use in drug design and development, particularly in targeting specific biological pathways or receptors due to its unique structural features. Its synthesis and characterization would typically involve standard organic chemistry techniques, and safety precautions should be observed due to the presence of fluorinated groups, which can pose environmental and health risks.
Formula:C15H18F6N2
InChI:InChI=1/C15H18F6N2/c16-14(17,18)10-7-11(15(19,20)21)9-13(8-10)23-6-4-12-3-1-2-5-22-12/h7-9,12,22-23H,1-6H2
InChI key:UMLGDRGOZSHCMY-UHFFFAOYSA-N
SMILES:C1CCNC(C1)CCNc1cc(cc(c1)C(F)(F)F)C(F)(F)F
Synonyms:
  • N-(2-piperidin-2-ylethyl)-3,5-bis(trifluoromethyl)aniline
Found 1 products.