
CAS 195383-80-3
:2-Bromo-4,5-dimethoxycinnamic acid
Description:
2-Bromo-4,5-dimethoxycinnamic acid is an organic compound characterized by its unique structure, which includes a cinnamic acid backbone substituted with bromine and methoxy groups. The presence of the bromine atom at the second position and two methoxy groups at the fourth and fifth positions contributes to its chemical reactivity and potential biological activity. This compound typically exhibits properties associated with cinnamic acids, such as being a solid at room temperature and having moderate solubility in organic solvents. Its molecular structure allows for potential applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. The methoxy groups can influence the compound's electronic properties and steric hindrance, affecting its interactions with biological targets. Additionally, the bromine substitution may enhance its reactivity in various chemical reactions, making it a valuable compound for further research in medicinal chemistry and material science. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H10BrO4
InChI:InChI=1/C11H11BrO4/c1-15-9-5-7(3-4-11(13)14)8(12)6-10(9)16-2/h3-6H,1-2H3,(H,13,14)/p-1/b4-3+
Synonyms:- (2E)-3-(2-bromo-4,5-dimethoxyphenyl)prop-2-enoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Bromo-4,5-dimethoxycinnamic acid
CAS:2-Bromo-4,5-dimethoxycinnamic acidFormula:C11H11BrO4Purity:97%Color and Shape: off-white crystals/ powderMolecular weight:287.11g/mol2-Bromo-4,5-dimethoxycinnamic acid
CAS:2-Bromo-4,5-dimethoxycinnamic acid is a dicarboxylic acid that belongs to the group of polysaccharides. It is a furan derivative with two methoxy groups on the cinnamic acid moiety. This compound can be found in plants and animals as well as in pyrolysis products from wood and other natural materials. 2-Bromo-4,5-dimethoxycinnamic acid has been analyzed by spectroscopy and pyrolysis to determine its chemical composition. The chemical composition was determined to contain caffeine and amines, as well as esters of fatty acids and alcohols.Formula:C11H11BrO4Purity:Min. 95%Color and Shape:PowderMolecular weight:287.11 g/mol


