CAS 1954-45-6: 4-Methyltryptophan
Description:4-Methyltryptophan is an amino acid derivative and a structural analog of tryptophan, characterized by the presence of a methyl group at the fourth position of the indole ring. This compound is notable for its role in biochemical research, particularly in studies related to protein synthesis and enzyme activity. It exhibits properties typical of amino acids, including the ability to participate in peptide bond formation and its involvement in various metabolic pathways. 4-Methyltryptophan can influence the activity of certain enzymes, such as tryptophan hydroxylase, and is often used in studies examining the effects of tryptophan metabolism on neurotransmitter synthesis. Additionally, it may exhibit unique biological activities, including potential effects on immune response and cellular signaling. The compound is typically available in a crystalline form and is soluble in polar solvents. As with many amino acid derivatives, it is important to handle 4-Methyltryptophan with care in laboratory settings, adhering to safety protocols to mitigate any potential hazards.
Formula:C12H14N2O2
InChI:InChI=1S/C12H14N2O2/c1-7-3-2-4-10-11(7)8(6-14-10)5-9(13)12(15)16/h2-4,6,9,14H,5,13H2,1H3,(H,15,16)
InChI key:InChIKey=FPJGLSZLQLNZIW-UHFFFAOYSA-N
SMILES:O=C(O)C(N)CC1=CNC2=CC=CC(=C21)C
- Synonyms:
- DL-4-Methyltryptophan
- DL-Tryptophan, 4-methyl-
- Tryptophan, 4-methyl-, DL-
- Tryptophan, 4-methyl-
- 4-Methyltryptophan
